About N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine
N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine (PubChem CID 19908737) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine.
Molecular Properties
| Compound Name | N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine |
| PubChem CID | 19908737 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine |
| SMILES | CCN=C=NC1COCCN1CC |
| InChI | InChI=1S/C9H17N3O/c1-3-10-8-11-9-7-13-6-5-12(9)4-2/h9H,3-7H2,1-2H3 |
| InChIKey | PTKAWNSXJBBNMM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine?
The IUPAC name of N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine (CID 19908737) is N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine.
What is the SMILES notation for N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine?
The canonical SMILES for N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine is CCN=C=NC1COCCN1CC.
What is the InChIKey of N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine?
The InChIKey is PTKAWNSXJBBNMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-3-10-8-11-9-7-13-6-5-12(9)4-2/h9H,3-7H2,1-2H3.
What are the key properties of N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine?
N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine has a molecular weight of 183.25 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(4-ethylmorpholin-3-yl)methanediimine is sourced from PubChem (CID 19908737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).