1,4-dimethylidenecyclohexane diisocyanate

C10H12N2O2-2 — CID 19909399

IUPAC1,4-dimethylidenecyclohexane diisocyanate
SMILESC=C1CCC(=C)CC1.[N-]=C=O.[N-]=C=O
InChIInChI=1S/C8H12.2CNO/c1-7-3-5-8(2)6-4-7;2*2-1-3/h1-6H2;;/q;2*-1
InChIKeyXPIBAMOZOZYJQZ-UHFFFAOYSA-N
MW192.22 g/mol
LogP2.46
Rot. Bonds

About 1,4-dimethylidenecyclohexane diisocyanate

1,4-dimethylidenecyclohexane diisocyanate (PubChem CID 19909399) has the molecular formula C10H12N2O2-2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1,4-dimethylidenecyclohexane diisocyanate.

Molecular Properties

Compound Name1,4-dimethylidenecyclohexane diisocyanate
PubChem CID19909399
Molecular FormulaC10H12N2O2-2
Molecular Weight192.22 g/mol
Exact Mass192.09
IUPAC Name1,4-dimethylidenecyclohexane diisocyanate
SMILESC=C1CCC(=C)CC1.[N-]=C=O.[N-]=C=O
InChIInChI=1S/C8H12.2CNO/c1-7-3-5-8(2)6-4-7;2*2-1-3/h1-6H2;;/q;2*-1
InChIKeyXPIBAMOZOZYJQZ-UHFFFAOYSA-N
XLogP2.46
TPSA78.74 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.22
LogP ≤ 52.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1,4-dimethylidenecyclohexane diisocyanate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dimethylidenecyclohexane diisocyanate?
The IUPAC name of 1,4-dimethylidenecyclohexane diisocyanate (CID 19909399) is 1,4-dimethylidenecyclohexane diisocyanate.
What is the SMILES notation for 1,4-dimethylidenecyclohexane diisocyanate?
The canonical SMILES for 1,4-dimethylidenecyclohexane diisocyanate is C=C1CCC(=C)CC1.[N-]=C=O.[N-]=C=O.
What is the InChIKey of 1,4-dimethylidenecyclohexane diisocyanate?
The InChIKey is XPIBAMOZOZYJQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.2CNO/c1-7-3-5-8(2)6-4-7;2*2-1-3/h1-6H2;;/q;2*-1.
What are the key properties of 1,4-dimethylidenecyclohexane diisocyanate?
1,4-dimethylidenecyclohexane diisocyanate has a molecular weight of 192.22 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylidenecyclohexane diisocyanate is sourced from PubChem (CID 19909399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).