About 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid
6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 19909418) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid |
| PubChem CID | 19909418 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | CN(C)C1C=CC(=[N+]=[N-])C(C(=O)O)=C1 |
| InChI | InChI=1S/C9H11N3O2/c1-12(2)6-3-4-8(11-10)7(5-6)9(13)14/h3-6H,1-2H3,(H,13,14) |
| InChIKey | KAODKNYDOXCZML-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid?
The IUPAC name of 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid (CID 19909418) is 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid?
The canonical SMILES for 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid is CN(C)C1C=CC(=[N+]=[N-])C(C(=O)O)=C1.
What is the InChIKey of 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid?
The InChIKey is KAODKNYDOXCZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-12(2)6-3-4-8(11-10)7(5-6)9(13)14/h3-6H,1-2H3,(H,13,14).
What are the key properties of 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid?
6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid has a molecular weight of 193.21 g/mol, XLogP of 0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazo-3-(dimethylamino)cyclohexa-1,4-diene-1-carboxylic acid is sourced from PubChem (CID 19909418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).