About 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine
4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine (PubChem CID 19909421) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine.
Molecular Properties
| Compound Name | 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine |
| PubChem CID | 19909421 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine |
| SMILES | COC1=CC(N2CCOCC2)C(OC)=CC1=[N+]=[N-] |
| InChI | InChI=1S/C12H17N3O3/c1-16-11-8-10(15-3-5-18-6-4-15)12(17-2)7-9(11)14-13/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | XGNAZFACYHDVIW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 67.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine?
The IUPAC name of 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine (CID 19909421) is 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine.
What is the SMILES notation for 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine?
The canonical SMILES for 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine is COC1=CC(N2CCOCC2)C(OC)=CC1=[N+]=[N-].
What is the InChIKey of 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine?
The InChIKey is XGNAZFACYHDVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-16-11-8-10(15-3-5-18-6-4-15)12(17-2)7-9(11)14-13/h7-8,10H,3-6H2,1-2H3.
What are the key properties of 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine?
4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine has a molecular weight of 251.29 g/mol, XLogP of 0.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-diazo-2,5-dimethoxycyclohexa-2,5-dien-1-yl)morpholine is sourced from PubChem (CID 19909421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).