About [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate
[4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate (PubChem CID 19910001) has the molecular formula C14H20N2S4
and a molecular weight of 344.60 g/mol. Its IUPAC name is [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate.
Molecular Properties
| Compound Name | [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate |
| PubChem CID | 19910001 |
| Molecular Formula | C14H20N2S4 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate |
| SMILES | CCNC(=S)SCc1ccc(CSC(=S)NCC)cc1 |
| InChI | InChI=1S/C14H20N2S4/c1-3-15-13(17)19-9-11-5-7-12(8-6-11)10-20-14(18)16-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | CUBQLRZPXRIHOL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate?
The IUPAC name of [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate (CID 19910001) is [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate.
What is the SMILES notation for [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate?
The canonical SMILES for [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate is CCNC(=S)SCc1ccc(CSC(=S)NCC)cc1.
What is the InChIKey of [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate?
The InChIKey is CUBQLRZPXRIHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2S4/c1-3-15-13(17)19-9-11-5-7-12(8-6-11)10-20-14(18)16-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,15,17)(H,16,18).
What are the key properties of [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate?
[4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate has a molecular weight of 344.60 g/mol, XLogP of 3.94, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(ethylcarbamothioylsulfanylmethyl)phenyl]methyl N-ethylcarbamodithioate is sourced from PubChem (CID 19910001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).