About 4-[(E)-prop-1-enyl]benzene-1,2,3-triol
4-[(E)-prop-1-enyl]benzene-1,2,3-triol (PubChem CID 19910343) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-[(E)-prop-1-enyl]benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 4-[(E)-prop-1-enyl]benzene-1,2,3-triol |
| PubChem CID | 19910343 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-[(E)-prop-1-enyl]benzene-1,2,3-triol |
| SMILES | C/C=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C9H10O3/c1-2-3-6-4-5-7(10)9(12)8(6)11/h2-5,10-12H,1H3/b3-2+ |
| InChIKey | YYXNFFVUWYWWOP-NSCUHMNNSA-N |
| XLogP | 1.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-prop-1-enyl]benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-prop-1-enyl]benzene-1,2,3-triol?
The IUPAC name of 4-[(E)-prop-1-enyl]benzene-1,2,3-triol (CID 19910343) is 4-[(E)-prop-1-enyl]benzene-1,2,3-triol.
What is the SMILES notation for 4-[(E)-prop-1-enyl]benzene-1,2,3-triol?
The canonical SMILES for 4-[(E)-prop-1-enyl]benzene-1,2,3-triol is C/C=C/c1ccc(O)c(O)c1O.
What is the InChIKey of 4-[(E)-prop-1-enyl]benzene-1,2,3-triol?
The InChIKey is YYXNFFVUWYWWOP-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H10O3/c1-2-3-6-4-5-7(10)9(12)8(6)11/h2-5,10-12H,1H3/b3-2+.
What are the key properties of 4-[(E)-prop-1-enyl]benzene-1,2,3-triol?
4-[(E)-prop-1-enyl]benzene-1,2,3-triol has a molecular weight of 166.18 g/mol, XLogP of 1.84, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-prop-1-enyl]benzene-1,2,3-triol is sourced from PubChem (CID 19910343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).