About cycloheptane-1,4-diamine
cycloheptane-1,4-diamine (PubChem CID 19910813) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is cycloheptane-1,4-diamine.
Molecular Properties
| Compound Name | cycloheptane-1,4-diamine |
| PubChem CID | 19910813 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | cycloheptane-1,4-diamine |
| SMILES | NC1CCCC(N)CC1 |
| InChI | InChI=1S/C7H16N2/c8-6-2-1-3-7(9)5-4-6/h6-7H,1-5,8-9H2 |
| InChIKey | LTYYPHXVTIFFLQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cycloheptane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptane-1,4-diamine?
The IUPAC name of cycloheptane-1,4-diamine (CID 19910813) is cycloheptane-1,4-diamine.
What is the SMILES notation for cycloheptane-1,4-diamine?
The canonical SMILES for cycloheptane-1,4-diamine is NC1CCCC(N)CC1.
What is the InChIKey of cycloheptane-1,4-diamine?
The InChIKey is LTYYPHXVTIFFLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c8-6-2-1-3-7(9)5-4-6/h6-7H,1-5,8-9H2.
What are the key properties of cycloheptane-1,4-diamine?
cycloheptane-1,4-diamine has a molecular weight of 128.22 g/mol, XLogP of 0.61, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptane-1,4-diamine is sourced from PubChem (CID 19910813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).