C7H7F5O — CID 19911061
1,3,3,4,4-pentafluoro-2-propan-2-yloxycyclobutene (PubChem CID 19911061) has the molecular formula C7H7F5O and a molecular weight of 202.12 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-propan-2-yloxycyclobutene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-propan-2-yloxycyclobutene |
|---|---|
| PubChem CID | 19911061 |
| Molecular Formula | C7H7F5O |
| Molecular Weight | 202.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-propan-2-yloxycyclobutene |
| SMILES | CC(C)OC1=C(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H7F5O/c1-3(2)13-5-4(8)6(9,10)7(5,11)12/h3H,1-2H3 |
| InChIKey | BHKJCVDWIKPBAG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.12 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|