About 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride
3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride (PubChem CID 19911230) has the molecular formula C17H31ClN2O3Si
and a molecular weight of 374.99 g/mol. Its IUPAC name is 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride.
Molecular Properties
| Compound Name | 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride |
| PubChem CID | 19911230 |
| Molecular Formula | C17H31ClN2O3Si |
| Molecular Weight | 374.99 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride |
| SMILES | C=Cc1ccccc1CNC(C)C(CN)C[Si](OC)(OC)OC.[Cl-].[H+] |
| InChI | InChI=1S/C17H30N2O3Si.ClH/c1-6-15-9-7-8-10-16(15)12-19-14(2)17(11-18)13-23(20-3,21-4)22-5;/h6-10,14,17,19H,1,11-13,18H2,2-5H3;1H |
| InChIKey | TYCPGGFHSRQPRU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.99 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride?
The IUPAC name of 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride (CID 19911230) is 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride.
What is the SMILES notation for 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride?
The canonical SMILES for 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride is C=Cc1ccccc1CNC(C)C(CN)C[Si](OC)(OC)OC.[Cl-].[H+].
What is the InChIKey of 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride?
The InChIKey is TYCPGGFHSRQPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O3Si.ClH/c1-6-15-9-7-8-10-16(15)12-19-14(2)17(11-18)13-23(20-3,21-4)22-5;/h6-10,14,17,19H,1,11-13,18H2,2-5H3;1H.
What are the key properties of 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride?
3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride has a molecular weight of 374.99 g/mol, XLogP of -0.62, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[(2-ethenylphenyl)methyl]-2-(trimethoxysilylmethyl)butane-1,3-diamine;hydron;chloride is sourced from PubChem (CID 19911230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).