About 5-cyclohexa-1,5-dien-1-ylpyrimidine
5-cyclohexa-1,5-dien-1-ylpyrimidine (PubChem CID 19911374) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-ylpyrimidine.
Molecular Properties
| Compound Name | 5-cyclohexa-1,5-dien-1-ylpyrimidine |
| PubChem CID | 19911374 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-ylpyrimidine |
| SMILES | C1=CC(c2cncnc2)=CCC1 |
| InChI | InChI=1S/C10H10N2/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h2,4-8H,1,3H2 |
| InChIKey | HCKSXQFDDFVRNS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclohexa-1,5-dien-1-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,5-dien-1-ylpyrimidine?
The IUPAC name of 5-cyclohexa-1,5-dien-1-ylpyrimidine (CID 19911374) is 5-cyclohexa-1,5-dien-1-ylpyrimidine.
What is the SMILES notation for 5-cyclohexa-1,5-dien-1-ylpyrimidine?
The canonical SMILES for 5-cyclohexa-1,5-dien-1-ylpyrimidine is C1=CC(c2cncnc2)=CCC1.
What is the InChIKey of 5-cyclohexa-1,5-dien-1-ylpyrimidine?
The InChIKey is HCKSXQFDDFVRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-4-9(5-3-1)10-6-11-8-12-7-10/h2,4-8H,1,3H2.
What are the key properties of 5-cyclohexa-1,5-dien-1-ylpyrimidine?
5-cyclohexa-1,5-dien-1-ylpyrimidine has a molecular weight of 158.20 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,5-dien-1-ylpyrimidine is sourced from PubChem (CID 19911374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).