C11H11Cl2NO2 — CID 19911452
5-(2-chloroethyl)-3-(3-chlorophenyl)-1,3-oxazolidin-2-one (PubChem CID 19911452) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is 5-(2-chloroethyl)-3-(3-chlorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(2-chloroethyl)-3-(3-chlorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 19911452 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-(2-chloroethyl)-3-(3-chlorophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CCCl)CN1c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO2/c12-5-4-10-7-14(11(15)16-10)9-3-1-2-8(13)6-9/h1-3,6,10H,4-5,7H2 |
| InChIKey | BMCCEWRNTODLDE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|