C25H29NO7S — CID 19911630
3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)phenyl]propanoic acid (PubChem CID 19911630) has the molecular formula C25H29NO7S and a molecular weight of 487.57 g/mol. Its IUPAC name is 3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)phenyl]propanoic acid.
| Compound Name | 3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19911630 |
| Molecular Formula | C25H29NO7S |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 3-[2-[(E)-6-(4-methoxyphenyl)hex-5-enoxy]-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)phenyl]propanoic acid |
| SMILES | COc1ccc(/C=C/CCCCOc2ccc(N3C(=O)CCS3(=O)=O)cc2CCC(=O)O)cc1 |
| InChI | InChI=1S/C25H29NO7S/c1-32-22-11-7-19(8-12-22)6-4-2-3-5-16-33-23-13-10-21(18-20(23)9-14-25(28)29)26-24(27)15-17-34(26,30)31/h4,6-8,10-13,18H,2-3,5,9,14-17H2,1H3,(H,28,29)/b6-4+ |
| InChIKey | DMPCMUPRFJTZPP-GQCTYLIASA-N |
| XLogP | 4.04 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|