About (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene
(4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene (PubChem CID 19911734) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene |
| PubChem CID | 19911734 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene |
| SMILES | C=C1CC2C=CC1C2.C=CC/C=C/C |
| InChI | InChI=1S/C8H10.C6H10/c1-6-4-7-2-3-8(6)5-7;1-3-5-6-4-2/h2-3,7-8H,1,4-5H2;3-4,6H,1,5H2,2H3/b;6-4+ |
| InChIKey | YEUFKEASSOJPQD-DVXCEAISSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene?
The IUPAC name of (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene (CID 19911734) is (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene?
The canonical SMILES for (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene is C=C1CC2C=CC1C2.C=CC/C=C/C.
What is the InChIKey of (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene?
The InChIKey is YEUFKEASSOJPQD-DVXCEAISSA-N. The full InChI is InChI=1S/C8H10.C6H10/c1-6-4-7-2-3-8(6)5-7;1-3-5-6-4-2/h2-3,7-8H,1,4-5H2;3-4,6H,1,5H2,2H3/b;6-4+.
What are the key properties of (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene?
(4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene has a molecular weight of 188.31 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-hexa-1,4-diene;5-methylidenebicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 19911734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).