About 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine
8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine (PubChem CID 19911816) has the molecular formula C23H23N5O
and a molecular weight of 385.47 g/mol. Its IUPAC name is 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine.
Molecular Properties
| Compound Name | 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine |
| PubChem CID | 19911816 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine |
| SMILES | CCCOC1=Nc2c(ncn2-c2ccccc2)C2=NC(Cc3ccccc3)CN12 |
| InChI | InChI=1S/C23H23N5O/c1-2-13-29-23-26-22-20(24-16-28(22)19-11-7-4-8-12-19)21-25-18(15-27(21)23)14-17-9-5-3-6-10-17/h3-12,16,18H,2,13-15H2,1H3 |
| InChIKey | JXRGBAIKUGLKHS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine?
The IUPAC name of 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine (CID 19911816) is 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine.
What is the SMILES notation for 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine?
The canonical SMILES for 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine is CCCOC1=Nc2c(ncn2-c2ccccc2)C2=NC(Cc3ccccc3)CN12.
What is the InChIKey of 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine?
The InChIKey is JXRGBAIKUGLKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N5O/c1-2-13-29-23-26-22-20(24-16-28(22)19-11-7-4-8-12-19)21-25-18(15-27(21)23)14-17-9-5-3-6-10-17/h3-12,16,18H,2,13-15H2,1H3.
What are the key properties of 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine?
8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine has a molecular weight of 385.47 g/mol, XLogP of 3.97, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-3-phenyl-5-propoxy-7,8-dihydroimidazo[2,1-f]purine is sourced from PubChem (CID 19911816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).