About [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate
[2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate (PubChem CID 19911910) has the molecular formula C10H15N3O4S
and a molecular weight of 273.31 g/mol. Its IUPAC name is [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate.
Molecular Properties
| Compound Name | [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate |
| PubChem CID | 19911910 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate |
| SMILES | CC(=O)OCC(=O)OCC(C)(C)c1nnc(N)s1 |
| InChI | InChI=1S/C10H15N3O4S/c1-6(14)16-4-7(15)17-5-10(2,3)8-12-13-9(11)18-8/h4-5H2,1-3H3,(H2,11,13) |
| InChIKey | FMIFNGFWGZYLHS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate?
The IUPAC name of [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate (CID 19911910) is [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate.
What is the SMILES notation for [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate?
The canonical SMILES for [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate is CC(=O)OCC(=O)OCC(C)(C)c1nnc(N)s1.
What is the InChIKey of [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate?
The InChIKey is FMIFNGFWGZYLHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4S/c1-6(14)16-4-7(15)17-5-10(2,3)8-12-13-9(11)18-8/h4-5H2,1-3H3,(H2,11,13).
What are the key properties of [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate?
[2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate has a molecular weight of 273.31 g/mol, XLogP of 0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-amino-1,3,4-thiadiazol-2-yl)-2-methylpropyl] 2-acetyloxyacetate is sourced from PubChem (CID 19911910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).