C13H17IO3 — CID 19912030
2,6-dipropoxybenzoyl iodide (PubChem CID 19912030) has the molecular formula C13H17IO3 and a molecular weight of 348.18 g/mol. Its IUPAC name is 2,6-dipropoxybenzoyl iodide.
| Compound Name | 2,6-dipropoxybenzoyl iodide |
|---|---|
| PubChem CID | 19912030 |
| Molecular Formula | C13H17IO3 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2,6-dipropoxybenzoyl iodide |
| SMILES | CCCOc1cccc(OCCC)c1C(=O)I |
| InChI | InChI=1S/C13H17IO3/c1-3-8-16-10-6-5-7-11(17-9-4-2)12(10)13(14)15/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | HDMVXIZCDOMRQM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|