2,6-dipropoxybenzoyl iodide

C13H17IO3 — CID 19912030

IUPAC2,6-dipropoxybenzoyl iodide
SMILESCCCOc1cccc(OCCC)c1C(=O)I
InChIInChI=1S/C13H17IO3/c1-3-8-16-10-6-5-7-11(17-9-4-2)12(10)13(14)15/h5-7H,3-4,8-9H2,1-2H3
InChIKeyHDMVXIZCDOMRQM-UHFFFAOYSA-N
MW348.18 g/mol
LogP3.84
Rot. Bonds7

About 2,6-dipropoxybenzoyl iodide

2,6-dipropoxybenzoyl iodide (PubChem CID 19912030) has the molecular formula C13H17IO3 and a molecular weight of 348.18 g/mol. Its IUPAC name is 2,6-dipropoxybenzoyl iodide.

Molecular Properties

Compound Name2,6-dipropoxybenzoyl iodide
PubChem CID19912030
Molecular FormulaC13H17IO3
Molecular Weight348.18 g/mol
Exact Mass348.02
IUPAC Name2,6-dipropoxybenzoyl iodide
SMILESCCCOc1cccc(OCCC)c1C(=O)I
InChIInChI=1S/C13H17IO3/c1-3-8-16-10-6-5-7-11(17-9-4-2)12(10)13(14)15/h5-7H,3-4,8-9H2,1-2H3
InChIKeyHDMVXIZCDOMRQM-UHFFFAOYSA-N
XLogP3.84
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.18
LogP ≤ 53.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2,6-dipropoxybenzoyl iodide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dipropoxybenzoyl iodide?
The IUPAC name of 2,6-dipropoxybenzoyl iodide (CID 19912030) is 2,6-dipropoxybenzoyl iodide.
What is the SMILES notation for 2,6-dipropoxybenzoyl iodide?
The canonical SMILES for 2,6-dipropoxybenzoyl iodide is CCCOc1cccc(OCCC)c1C(=O)I.
What is the InChIKey of 2,6-dipropoxybenzoyl iodide?
The InChIKey is HDMVXIZCDOMRQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17IO3/c1-3-8-16-10-6-5-7-11(17-9-4-2)12(10)13(14)15/h5-7H,3-4,8-9H2,1-2H3.
What are the key properties of 2,6-dipropoxybenzoyl iodide?
2,6-dipropoxybenzoyl iodide has a molecular weight of 348.18 g/mol, XLogP of 3.84, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dipropoxybenzoyl iodide is sourced from PubChem (CID 19912030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).