About 1,5-dibromo-2,6-dichlorocyclododecane
1,5-dibromo-2,6-dichlorocyclododecane (PubChem CID 19912716) has the molecular formula C12H20Br2Cl2
and a molecular weight of 395.01 g/mol. Its IUPAC name is 1,5-dibromo-2,6-dichlorocyclododecane.
Molecular Properties
| Compound Name | 1,5-dibromo-2,6-dichlorocyclododecane |
| PubChem CID | 19912716 |
| Molecular Formula | C12H20Br2Cl2 |
| Molecular Weight | 395.01 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 1,5-dibromo-2,6-dichlorocyclododecane |
| SMILES | ClC1CCC(Br)C(Cl)CCCCCCC1Br |
| InChI | InChI=1S/C12H20Br2Cl2/c13-9-5-3-1-2-4-6-11(15)10(14)7-8-12(9)16/h9-12H,1-8H2 |
| InChIKey | MORHLMMHRDVYMM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.01 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dibromo-2,6-dichlorocyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibromo-2,6-dichlorocyclododecane?
The IUPAC name of 1,5-dibromo-2,6-dichlorocyclododecane (CID 19912716) is 1,5-dibromo-2,6-dichlorocyclododecane.
What is the SMILES notation for 1,5-dibromo-2,6-dichlorocyclododecane?
The canonical SMILES for 1,5-dibromo-2,6-dichlorocyclododecane is ClC1CCC(Br)C(Cl)CCCCCCC1Br.
What is the InChIKey of 1,5-dibromo-2,6-dichlorocyclododecane?
The InChIKey is MORHLMMHRDVYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Br2Cl2/c13-9-5-3-1-2-4-6-11(15)10(14)7-8-12(9)16/h9-12H,1-8H2.
What are the key properties of 1,5-dibromo-2,6-dichlorocyclododecane?
1,5-dibromo-2,6-dichlorocyclododecane has a molecular weight of 395.01 g/mol, XLogP of 5.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibromo-2,6-dichlorocyclododecane is sourced from PubChem (CID 19912716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).