About cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone
cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone (PubChem CID 19912732) has the molecular formula C26H34O3
and a molecular weight of 394.56 g/mol. Its IUPAC name is cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone.
Molecular Properties
| Compound Name | cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone |
| PubChem CID | 19912732 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone |
| SMILES | C1CCC(OC2CCCCC2)CC1.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C12H22O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13,15H;11-12H,1-10H2 |
| InChIKey | UBPWQXYHRHNLQY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone?
The IUPAC name of cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone (CID 19912732) is cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone.
What is the SMILES notation for cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone?
The canonical SMILES for cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone is C1CCC(OC2CCCCC2)CC1.O=C(c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone?
The InChIKey is UBPWQXYHRHNLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C12H22O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13,15H;11-12H,1-10H2.
What are the key properties of cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone?
cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone has a molecular weight of 394.56 g/mol, XLogP of 6.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyloxycyclohexane;2-hydroxy-1,2-diphenylethanone is sourced from PubChem (CID 19912732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).