About 2,3,4-triaminophenol
2,3,4-triaminophenol (PubChem CID 19912768) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2,3,4-triaminophenol.
Molecular Properties
| Compound Name | 2,3,4-triaminophenol |
| PubChem CID | 19912768 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 2,3,4-triaminophenol |
| SMILES | Nc1ccc(O)c(N)c1N |
| InChI | InChI=1S/C6H9N3O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H,7-9H2 |
| InChIKey | XTNHVTIXTMOWGU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-triaminophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-triaminophenol?
The IUPAC name of 2,3,4-triaminophenol (CID 19912768) is 2,3,4-triaminophenol.
What is the SMILES notation for 2,3,4-triaminophenol?
The canonical SMILES for 2,3,4-triaminophenol is Nc1ccc(O)c(N)c1N.
What is the InChIKey of 2,3,4-triaminophenol?
The InChIKey is XTNHVTIXTMOWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H,7-9H2.
What are the key properties of 2,3,4-triaminophenol?
2,3,4-triaminophenol has a molecular weight of 139.16 g/mol, XLogP of 0.14, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-triaminophenol is sourced from PubChem (CID 19912768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).