About 1-methoxyethylbenzene
1-methoxyethylbenzene (PubChem CID 19913) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 1-methoxyethylbenzene.
Molecular Properties
| Compound Name | 1-methoxyethylbenzene |
| PubChem CID | 19913 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 1-methoxyethylbenzene |
| SMILES | COC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12O/c1-8(10-2)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | PLKSMSKTENNPEJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxyethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethylbenzene?
The IUPAC name of 1-methoxyethylbenzene (CID 19913) is 1-methoxyethylbenzene.
What is the SMILES notation for 1-methoxyethylbenzene?
The canonical SMILES for 1-methoxyethylbenzene is COC(C)c1ccccc1.
What is the InChIKey of 1-methoxyethylbenzene?
The InChIKey is PLKSMSKTENNPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-8(10-2)9-6-4-3-5-7-9/h3-8H,1-2H3.
What are the key properties of 1-methoxyethylbenzene?
1-methoxyethylbenzene has a molecular weight of 136.19 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethylbenzene is sourced from PubChem (CID 19913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).