About 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone
1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 19913863) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone |
| PubChem CID | 19913863 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | CCC1(O)C=C(O)C=C(C(C)=O)C1 |
| InChI | InChI=1S/C10H14O3/c1-3-10(13)5-8(7(2)11)4-9(12)6-10/h4,6,12-13H,3,5H2,1-2H3 |
| InChIKey | SYUKBESARMJCJK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone?
The IUPAC name of 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone (CID 19913863) is 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone.
What is the SMILES notation for 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone?
The canonical SMILES for 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone is CCC1(O)C=C(O)C=C(C(C)=O)C1.
What is the InChIKey of 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone?
The InChIKey is SYUKBESARMJCJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-3-10(13)5-8(7(2)11)4-9(12)6-10/h4,6,12-13H,3,5H2,1-2H3.
What are the key properties of 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone?
1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone has a molecular weight of 182.22 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-3,5-dihydroxycyclohexa-1,3-dien-1-yl)ethanone is sourced from PubChem (CID 19913863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).