About azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate
azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate (PubChem CID 19913953) has the molecular formula C11H11NO6S
and a molecular weight of 285.28 g/mol. Its IUPAC name is azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate.
Molecular Properties
| Compound Name | azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate |
| PubChem CID | 19913953 |
| Molecular Formula | C11H11NO6S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)C(S(=O)(=O)[O-])=C2.[NH4+] |
| InChI | InChI=1S/C11H8O6S.H3N/c1-17-7-3-2-6-4-9(18(14,15)16)11(13)10(12)8(6)5-7;/h2-5H,1H3,(H,14,15,16);1H3 |
| InChIKey | QKFHVRXMQQLITA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate?
The IUPAC name of azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate (CID 19913953) is azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate.
What is the SMILES notation for azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate?
The canonical SMILES for azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate is COc1ccc2c(c1)C(=O)C(=O)C(S(=O)(=O)[O-])=C2.[NH4+].
What is the InChIKey of azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate?
The InChIKey is QKFHVRXMQQLITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O6S.H3N/c1-17-7-3-2-6-4-9(18(14,15)16)11(13)10(12)8(6)5-7;/h2-5H,1H3,(H,14,15,16);1H3.
What are the key properties of azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate?
azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate has a molecular weight of 285.28 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 6-methoxy-3,4-dioxonaphthalene-2-sulfonate is sourced from PubChem (CID 19913953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).