About oxalic acid;pyrrolidine-2,5-dione
oxalic acid;pyrrolidine-2,5-dione (PubChem CID 19913999) has the molecular formula C6H7NO6
and a molecular weight of 189.12 g/mol. Its IUPAC name is oxalic acid;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | oxalic acid;pyrrolidine-2,5-dione |
| PubChem CID | 19913999 |
| Molecular Formula | C6H7NO6 |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | oxalic acid;pyrrolidine-2,5-dione |
| SMILES | O=C(O)C(=O)O.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C2H2O4/c6-3-1-2-4(7)5-3;3-1(4)2(5)6/h1-2H2,(H,5,6,7);(H,3,4)(H,5,6) |
| InChIKey | GSJFICIEPOAQHQ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;pyrrolidine-2,5-dione?
The IUPAC name of oxalic acid;pyrrolidine-2,5-dione (CID 19913999) is oxalic acid;pyrrolidine-2,5-dione.
What is the SMILES notation for oxalic acid;pyrrolidine-2,5-dione?
The canonical SMILES for oxalic acid;pyrrolidine-2,5-dione is O=C(O)C(=O)O.O=C1CCC(=O)N1.
What is the InChIKey of oxalic acid;pyrrolidine-2,5-dione?
The InChIKey is GSJFICIEPOAQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C2H2O4/c6-3-1-2-4(7)5-3;3-1(4)2(5)6/h1-2H2,(H,5,6,7);(H,3,4)(H,5,6).
What are the key properties of oxalic acid;pyrrolidine-2,5-dione?
oxalic acid;pyrrolidine-2,5-dione has a molecular weight of 189.12 g/mol, XLogP of -1.42, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;pyrrolidine-2,5-dione is sourced from PubChem (CID 19913999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).