About 3-(2-aminoethyl)-1,2-dihydroindol-3-ol
3-(2-aminoethyl)-1,2-dihydroindol-3-ol (PubChem CID 19914408) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1,2-dihydroindol-3-ol.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-1,2-dihydroindol-3-ol |
| PubChem CID | 19914408 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-(2-aminoethyl)-1,2-dihydroindol-3-ol |
| SMILES | NCCC1(O)CNc2ccccc21 |
| InChI | InChI=1S/C10H14N2O/c11-6-5-10(13)7-12-9-4-2-1-3-8(9)10/h1-4,12-13H,5-7,11H2 |
| InChIKey | VGKCTIARNXIVBK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-aminoethyl)-1,2-dihydroindol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-1,2-dihydroindol-3-ol?
The IUPAC name of 3-(2-aminoethyl)-1,2-dihydroindol-3-ol (CID 19914408) is 3-(2-aminoethyl)-1,2-dihydroindol-3-ol.
What is the SMILES notation for 3-(2-aminoethyl)-1,2-dihydroindol-3-ol?
The canonical SMILES for 3-(2-aminoethyl)-1,2-dihydroindol-3-ol is NCCC1(O)CNc2ccccc21.
What is the InChIKey of 3-(2-aminoethyl)-1,2-dihydroindol-3-ol?
The InChIKey is VGKCTIARNXIVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c11-6-5-10(13)7-12-9-4-2-1-3-8(9)10/h1-4,12-13H,5-7,11H2.
What are the key properties of 3-(2-aminoethyl)-1,2-dihydroindol-3-ol?
3-(2-aminoethyl)-1,2-dihydroindol-3-ol has a molecular weight of 178.24 g/mol, XLogP of 0.65, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-1,2-dihydroindol-3-ol is sourced from PubChem (CID 19914408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).