About 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid
7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 19914648) has the molecular formula C18H24ClN3O4
and a molecular weight of 381.86 g/mol. Its IUPAC name is 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid.
Molecular Properties
| Compound Name | 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid |
| PubChem CID | 19914648 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC(C)c1nnn(-c2ccc(Cl)cc2)c1CCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C18H24ClN3O4/c1-11(2)18-16(8-7-14(23)9-15(24)10-17(25)26)22(21-20-18)13-5-3-12(19)4-6-13/h3-6,11,14-15,23-24H,7-10H2,1-2H3,(H,25,26) |
| InChIKey | QLCKPHFDHJWJCD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid?
The IUPAC name of 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid (CID 19914648) is 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid.
What is the SMILES notation for 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid?
The canonical SMILES for 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid is CC(C)c1nnn(-c2ccc(Cl)cc2)c1CCC(O)CC(O)CC(=O)O.
What is the InChIKey of 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid?
The InChIKey is QLCKPHFDHJWJCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClN3O4/c1-11(2)18-16(8-7-14(23)9-15(24)10-17(25)26)22(21-20-18)13-5-3-12(19)4-6-13/h3-6,11,14-15,23-24H,7-10H2,1-2H3,(H,25,26).
What are the key properties of 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid?
7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid has a molecular weight of 381.86 g/mol, XLogP of 2.56, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(4-chlorophenyl)-5-propan-2-yltriazol-4-yl]-3,5-dihydroxyheptanoic acid is sourced from PubChem (CID 19914648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).