About 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid
3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid (PubChem CID 19914713) has the molecular formula C20H29NO2S
and a molecular weight of 347.52 g/mol. Its IUPAC name is 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid |
| PubChem CID | 19914713 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)c1ccc2[nH]c(CC(C)(C)C(=O)O)c(SC(C)(C)C)c2c1 |
| InChI | InChI=1S/C20H29NO2S/c1-12(2)13-8-9-15-14(10-13)17(24-19(3,4)5)16(21-15)11-20(6,7)18(22)23/h8-10,12,21H,11H2,1-7H3,(H,22,23) |
| InChIKey | NKZRUZUSLYDMTQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid (CID 19914713) is 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid is CC(C)c1ccc2[nH]c(CC(C)(C)C(=O)O)c(SC(C)(C)C)c2c1.
What is the InChIKey of 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid?
The InChIKey is NKZRUZUSLYDMTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO2S/c1-12(2)13-8-9-15-14(10-13)17(24-19(3,4)5)16(21-15)11-20(6,7)18(22)23/h8-10,12,21H,11H2,1-7H3,(H,22,23).
What are the key properties of 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid?
3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid has a molecular weight of 347.52 g/mol, XLogP of 5.84, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butylsulfanyl-5-propan-2-yl-1H-indol-2-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 19914713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).