C43H26F6N4O6 — CID 19914845
2-[4-(4-aminophenoxy)phenyl]-5-[2-[2-[4-(4-aminophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione (PubChem CID 19914845) has the molecular formula C43H26F6N4O6 and a molecular weight of 808.69 g/mol. Its IUPAC name is 2-[4-(4-aminophenoxy)phenyl]-5-[2-[2-[4-(4-aminophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-aminophenoxy)phenyl]-5-[2-[2-[4-(4-aminophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19914845 |
| Molecular Formula | C43H26F6N4O6 |
| Molecular Weight | 808.69 g/mol |
| Exact Mass | 808.18 |
| IUPAC Name | 2-[4-(4-aminophenoxy)phenyl]-5-[2-[2-[4-(4-aminophenoxy)phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
| SMILES | Nc1ccc(Oc2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(c5ccc(Oc7ccc(N)cc7)cc5)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C43H26F6N4O6/c44-42(45,46)41(43(47,48)49,23-1-19-33-35(21-23)39(56)52(37(33)54)27-7-15-31(16-8-27)58-29-11-3-25(50)4-12-29)24-2-20-34-36(22-24)40(57)53(38(34)55)28-9-17-32(18-10-28)59-30-13-5-26(51)6-14-30/h1-22H,50-51H2 |
| InChIKey | OYEWMCNRYOWJEO-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.69 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|