About CID 19914851
CID 19914851 (PubChem CID 19914851) has the molecular formula C35H26F6N2O4Si2
and a molecular weight of 708.76 g/mol.
Molecular Properties
| Compound Name | CID 19914851 |
| PubChem CID | 19914851 |
| Molecular Formula | C35H26F6N2O4Si2 |
| Molecular Weight | 708.76 g/mol |
| Exact Mass | 708.13 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1ccc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4ccc([Si](C)C)cc4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)cc1 |
| InChI | InChI=1S/C35H26F6N2O4Si2/c1-48(2)23-11-7-21(8-12-23)42-29(44)25-15-5-19(17-27(25)31(42)46)33(34(36,37)38,35(39,40)41)20-6-16-26-28(18-20)32(47)43(30(26)45)22-9-13-24(14-10-22)49(3)4/h5-18H,1-4H3 |
| InChIKey | NJGUXQBFFQNOER-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 708.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 19914851 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19914851?
The IUPAC name of CID 19914851 (CID 19914851) is not available.
What is the SMILES notation for CID 19914851?
The canonical SMILES for CID 19914851 is C[Si](C)c1ccc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(c4ccc([Si](C)C)cc4)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)cc1.
What is the InChIKey of CID 19914851?
The InChIKey is NJGUXQBFFQNOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H26F6N2O4Si2/c1-48(2)23-11-7-21(8-12-23)42-29(44)25-15-5-19(17-27(25)31(42)46)33(34(36,37)38,35(39,40)41)20-6-16-26-28(18-20)32(47)43(30(26)45)22-9-13-24(14-10-22)49(3)4/h5-18H,1-4H3.
What are the key properties of CID 19914851?
CID 19914851 has a molecular weight of 708.76 g/mol, XLogP of 6.62, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19914851 is sourced from PubChem (CID 19914851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).