About 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran
2-butoxy-3-hexyl-3,6-dihydro-2H-pyran (PubChem CID 19915123) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran |
| PubChem CID | 19915123 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran |
| SMILES | CCCCCCC1C=CCOC1OCCCC |
| InChI | InChI=1S/C15H28O2/c1-3-5-7-8-10-14-11-9-13-17-15(14)16-12-6-4-2/h9,11,14-15H,3-8,10,12-13H2,1-2H3 |
| InChIKey | RFHLSQVUEOVVPQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran?
The IUPAC name of 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran (CID 19915123) is 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran?
The canonical SMILES for 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran is CCCCCCC1C=CCOC1OCCCC.
What is the InChIKey of 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran?
The InChIKey is RFHLSQVUEOVVPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-3-5-7-8-10-14-11-9-13-17-15(14)16-12-6-4-2/h9,11,14-15H,3-8,10,12-13H2,1-2H3.
What are the key properties of 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran?
2-butoxy-3-hexyl-3,6-dihydro-2H-pyran has a molecular weight of 240.39 g/mol, XLogP of 4.30, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3-hexyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 19915123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).