About 9-hydroxynonyl benzoate
9-hydroxynonyl benzoate (PubChem CID 19915374) has the molecular formula C16H24O3
and a molecular weight of 264.36 g/mol. Its IUPAC name is 9-hydroxynonyl benzoate.
Molecular Properties
| Compound Name | 9-hydroxynonyl benzoate |
| PubChem CID | 19915374 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 9-hydroxynonyl benzoate |
| SMILES | O=C(OCCCCCCCCCO)c1ccccc1 |
| InChI | InChI=1S/C16H24O3/c17-13-9-4-2-1-3-5-10-14-19-16(18)15-11-7-6-8-12-15/h6-8,11-12,17H,1-5,9-10,13-14H2 |
| InChIKey | ZMFJSDIUBKIJBI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxynonyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxynonyl benzoate?
The IUPAC name of 9-hydroxynonyl benzoate (CID 19915374) is 9-hydroxynonyl benzoate.
What is the SMILES notation for 9-hydroxynonyl benzoate?
The canonical SMILES for 9-hydroxynonyl benzoate is O=C(OCCCCCCCCCO)c1ccccc1.
What is the InChIKey of 9-hydroxynonyl benzoate?
The InChIKey is ZMFJSDIUBKIJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c17-13-9-4-2-1-3-5-10-14-19-16(18)15-11-7-6-8-12-15/h6-8,11-12,17H,1-5,9-10,13-14H2.
What are the key properties of 9-hydroxynonyl benzoate?
9-hydroxynonyl benzoate has a molecular weight of 264.36 g/mol, XLogP of 3.57, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxynonyl benzoate is sourced from PubChem (CID 19915374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).