C9H8F13N — CID 19915597
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononan-3-amine (PubChem CID 19915597) has the molecular formula C9H8F13N and a molecular weight of 377.14 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononan-3-amine.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononan-3-amine |
|---|---|
| PubChem CID | 19915597 |
| Molecular Formula | C9H8F13N |
| Molecular Weight | 377.14 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononan-3-amine |
| SMILES | CCC(N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F13N/c1-2-3(23)4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h3H,2,23H2,1H3 |
| InChIKey | UBAZKVIQRZKRCU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|