C19H12ClF3N4O2 — CID 19916289
methyl 4-(4-chlorophenyl)-13-methyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate (PubChem CID 19916289) has the molecular formula C19H12ClF3N4O2 and a molecular weight of 420.78 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-13-methyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-13-methyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate |
|---|---|
| PubChem CID | 19916289 |
| Molecular Formula | C19H12ClF3N4O2 |
| Molecular Weight | 420.78 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-13-methyl-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(Cl)cc2)nc2c3c(C)cc(C(F)(F)F)nc3nn12 |
| InChI | InChI=1S/C19H12ClF3N4O2/c1-9-7-14(19(21,22)23)25-16-15(9)17-24-12(10-3-5-11(20)6-4-10)8-13(18(28)29-2)27(17)26-16/h3-8H,1-2H3 |
| InChIKey | DIHIXZDCQDUVRB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |