C18H26O2 — CID 19917256
1-(2,3,4,5-tetraethylphenyl)butane-1,3-dione (PubChem CID 19917256) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-(2,3,4,5-tetraethylphenyl)butane-1,3-dione.
| Compound Name | 1-(2,3,4,5-tetraethylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 19917256 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-(2,3,4,5-tetraethylphenyl)butane-1,3-dione |
| SMILES | CCc1cc(C(=O)CC(C)=O)c(CC)c(CC)c1CC |
| InChI | InChI=1S/C18H26O2/c1-6-13-11-17(18(20)10-12(5)19)16(9-4)15(8-3)14(13)7-2/h11H,6-10H2,1-5H3 |
| InChIKey | UIUWXHHYTLITFY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|