C6H6F4I2 — CID 19917283
1,2,4,5-tetrafluoro-3,6-diiodocyclohexane (PubChem CID 19917283) has the molecular formula C6H6F4I2 and a molecular weight of 407.91 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-diiodocyclohexane.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-diiodocyclohexane |
|---|---|
| PubChem CID | 19917283 |
| Molecular Formula | C6H6F4I2 |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.85 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-diiodocyclohexane |
| SMILES | FC1C(F)C(I)C(F)C(F)C1I |
| InChI | InChI=1S/C6H6F4I2/c7-1-2(8)6(12)4(10)3(9)5(1)11/h1-6H |
| InChIKey | GUAYJJRRZBVONY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|