About methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate
methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate (PubChem CID 19918048) has the molecular formula C34H30N2O3S2
and a molecular weight of 578.76 g/mol. Its IUPAC name is methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate.
Molecular Properties
| Compound Name | methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate |
| PubChem CID | 19918048 |
| Molecular Formula | C34H30N2O3S2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate |
| SMILES | CSC(=S)NCc1cc(=O)c(OC(c2ccccc2)c2ccccc2)cn1OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H30N2O3S2/c1-41-34(40)35-23-29-22-30(37)31(38-32(25-14-6-2-7-15-25)26-16-8-3-9-17-26)24-36(29)39-33(27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-22,24,32-33H,23H2,1H3,(H,35,40) |
| InChIKey | SXSDPBVIFBHJOS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate?
The IUPAC name of methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate (CID 19918048) is methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate.
What is the SMILES notation for methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate?
The canonical SMILES for methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate is CSC(=S)NCc1cc(=O)c(OC(c2ccccc2)c2ccccc2)cn1OC(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate?
The InChIKey is SXSDPBVIFBHJOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30N2O3S2/c1-41-34(40)35-23-29-22-30(37)31(38-32(25-14-6-2-7-15-25)26-16-8-3-9-17-26)24-36(29)39-33(27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-22,24,32-33H,23H2,1H3,(H,35,40).
What are the key properties of methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate?
methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate has a molecular weight of 578.76 g/mol, XLogP of 6.97, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(1,5-dibenzhydryloxy-4-oxo-2-pyridinyl)methyl]carbamodithioate is sourced from PubChem (CID 19918048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).