C35H30N4O3S2 — CID 19918056
1,5-dibenzhydryloxy-2-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)sulfanylmethyl]pyridin-4-one (PubChem CID 19918056) has the molecular formula C35H30N4O3S2 and a molecular weight of 618.78 g/mol. Its IUPAC name is 1,5-dibenzhydryloxy-2-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)sulfanylmethyl]pyridin-4-one.
| Compound Name | 1,5-dibenzhydryloxy-2-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)sulfanylmethyl]pyridin-4-one |
|---|---|
| PubChem CID | 19918056 |
| Molecular Formula | C35H30N4O3S2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | 1,5-dibenzhydryloxy-2-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)sulfanylmethyl]pyridin-4-one |
| SMILES | Cn1c(SCc2cc(=O)c(OC(c3ccccc3)c3ccccc3)cn2OC(c2ccccc2)c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C35H30N4O3S2/c1-38-34(43)36-37-35(38)44-24-29-22-30(40)31(41-32(25-14-6-2-7-15-25)26-16-8-3-9-17-26)23-39(29)42-33(27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-23,32-33H,24H2,1H3,(H,36,43) |
| InChIKey | NPDDXNAWDUTVIA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|