C35H28N2O3S3 — CID 19918062
1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3-thiazol-4-yl)sulfanylmethyl]pyridin-4-one (PubChem CID 19918062) has the molecular formula C35H28N2O3S3 and a molecular weight of 620.82 g/mol. Its IUPAC name is 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3-thiazol-4-yl)sulfanylmethyl]pyridin-4-one.
| Compound Name | 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3-thiazol-4-yl)sulfanylmethyl]pyridin-4-one |
|---|---|
| PubChem CID | 19918062 |
| Molecular Formula | C35H28N2O3S3 |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3-thiazol-4-yl)sulfanylmethyl]pyridin-4-one |
| SMILES | O=c1cc(CSc2csc(=S)[nH]2)n(OC(c2ccccc2)c2ccccc2)cc1OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H28N2O3S3/c38-30-21-29(23-42-32-24-43-35(41)36-32)37(40-34(27-17-9-3-10-18-27)28-19-11-4-12-20-28)22-31(30)39-33(25-13-5-1-6-14-25)26-15-7-2-8-16-26/h1-22,24,33-34H,23H2,(H,36,41) |
| InChIKey | YOXAPKQNHLRCLY-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|