C34H27N3O3S2 — CID 19918086
1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methyl]pyridin-4-one (PubChem CID 19918086) has the molecular formula C34H27N3O3S2 and a molecular weight of 589.74 g/mol. Its IUPAC name is 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methyl]pyridin-4-one.
| Compound Name | 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methyl]pyridin-4-one |
|---|---|
| PubChem CID | 19918086 |
| Molecular Formula | C34H27N3O3S2 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)methyl]pyridin-4-one |
| SMILES | O=c1cc(Cc2n[nH]c(=S)s2)n(OC(c2ccccc2)c2ccccc2)cc1OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H27N3O3S2/c38-29-21-28(22-31-35-36-34(41)42-31)37(40-33(26-17-9-3-10-18-26)27-19-11-4-12-20-27)23-30(29)39-32(24-13-5-1-6-14-24)25-15-7-2-8-16-25/h1-21,23,32-33H,22H2,(H,36,41) |
| InChIKey | JDWLOZSRPNAGEQ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|