C45H59N7O4 — CID 19918421
4-[4-[(1-benzylpiperidin-4-yl)carbamoyl]anilino]-N-[1-[6-(diethylamino)-6-oxohexyl]piperidin-4-yl]-8-methoxyquinoline-3-carboxamide (PubChem CID 19918421) has the molecular formula C45H59N7O4 and a molecular weight of 762.01 g/mol. Its IUPAC name is 4-[4-[(1-benzylpiperidin-4-yl)carbamoyl]anilino]-N-[1-[6-(diethylamino)-6-oxohexyl]piperidin-4-yl]-8-methoxyquinoline-3-carboxamide.
| Compound Name | 4-[4-[(1-benzylpiperidin-4-yl)carbamoyl]anilino]-N-[1-[6-(diethylamino)-6-oxohexyl]piperidin-4-yl]-8-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 19918421 |
| Molecular Formula | C45H59N7O4 |
| Molecular Weight | 762.01 g/mol |
| Exact Mass | 761.46 |
| IUPAC Name | 4-[4-[(1-benzylpiperidin-4-yl)carbamoyl]anilino]-N-[1-[6-(diethylamino)-6-oxohexyl]piperidin-4-yl]-8-methoxyquinoline-3-carboxamide |
| SMILES | CCN(CC)C(=O)CCCCCN1CCC(NC(=O)c2cnc3c(OC)cccc3c2Nc2ccc(C(=O)NC3CCN(Cc4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C45H59N7O4/c1-4-52(5-2)41(53)17-10-7-11-26-50-27-22-37(23-28-50)49-45(55)39-31-46-43-38(15-12-16-40(43)56-3)42(39)47-35-20-18-34(19-21-35)44(54)48-36-24-29-51(30-25-36)32-33-13-8-6-9-14-33/h6,8-9,12-16,18-21,31,36-37H,4-5,7,10-11,17,22-30,32H2,1-3H3,(H,46,47)(H,48,54)(H,49,55) |
| InChIKey | AFIGIJWNAYQRPU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.01 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|