About 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine
1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine (PubChem CID 19918604) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine |
| PubChem CID | 19918604 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine |
| SMILES | CC(N)C1=CCC(OC(C)(C)C)=CC1 |
| InChI | InChI=1S/C12H21NO/c1-9(13)10-5-7-11(8-6-10)14-12(2,3)4/h5,8-9H,6-7,13H2,1-4H3 |
| InChIKey | LJNLDOURJYRSNF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine?
The IUPAC name of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine (CID 19918604) is 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine.
What is the SMILES notation for 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine?
The canonical SMILES for 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine is CC(N)C1=CCC(OC(C)(C)C)=CC1.
What is the InChIKey of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine?
The InChIKey is LJNLDOURJYRSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-9(13)10-5-7-11(8-6-10)14-12(2,3)4/h5,8-9H,6-7,13H2,1-4H3.
What are the key properties of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine?
1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine has a molecular weight of 195.31 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,4-dien-1-yl]ethanamine is sourced from PubChem (CID 19918604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).