About benzyl 5-aminopentanoate;hydrochloride
benzyl 5-aminopentanoate;hydrochloride (PubChem CID 19918720) has the molecular formula C12H18ClNO2
and a molecular weight of 243.73 g/mol. Its IUPAC name is benzyl 5-aminopentanoate;hydrochloride.
Molecular Properties
| Compound Name | benzyl 5-aminopentanoate;hydrochloride |
| PubChem CID | 19918720 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | benzyl 5-aminopentanoate;hydrochloride |
| SMILES | Cl.NCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H17NO2.ClH/c13-9-5-4-8-12(14)15-10-11-6-2-1-3-7-11;/h1-3,6-7H,4-5,8-10,13H2;1H |
| InChIKey | BXYROAZHUJRZPD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl 5-aminopentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-aminopentanoate;hydrochloride?
The IUPAC name of benzyl 5-aminopentanoate;hydrochloride (CID 19918720) is benzyl 5-aminopentanoate;hydrochloride.
What is the SMILES notation for benzyl 5-aminopentanoate;hydrochloride?
The canonical SMILES for benzyl 5-aminopentanoate;hydrochloride is Cl.NCCCCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 5-aminopentanoate;hydrochloride?
The InChIKey is BXYROAZHUJRZPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.ClH/c13-9-5-4-8-12(14)15-10-11-6-2-1-3-7-11;/h1-3,6-7H,4-5,8-10,13H2;1H.
What are the key properties of benzyl 5-aminopentanoate;hydrochloride?
benzyl 5-aminopentanoate;hydrochloride has a molecular weight of 243.73 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-aminopentanoate;hydrochloride is sourced from PubChem (CID 19918720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).