About 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde
3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde (PubChem CID 19918772) has the molecular formula C18H11F2NO
and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde |
| PubChem CID | 19918772 |
| Molecular Formula | C18H11F2NO |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde |
| SMILES | O=Cc1cccc(/C=C/c2ccc3cc(F)c(F)cc3n2)c1 |
| InChI | InChI=1S/C18H11F2NO/c19-16-9-14-5-7-15(21-18(14)10-17(16)20)6-4-12-2-1-3-13(8-12)11-22/h1-11H/b6-4+ |
| InChIKey | SCCWWJWUZUKKRY-GQCTYLIASA-N |
| XLogP | 4.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde?
The IUPAC name of 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde (CID 19918772) is 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde.
What is the SMILES notation for 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde?
The canonical SMILES for 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde is O=Cc1cccc(/C=C/c2ccc3cc(F)c(F)cc3n2)c1.
What is the InChIKey of 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde?
The InChIKey is SCCWWJWUZUKKRY-GQCTYLIASA-N. The full InChI is InChI=1S/C18H11F2NO/c19-16-9-14-5-7-15(21-18(14)10-17(16)20)6-4-12-2-1-3-13(8-12)11-22/h1-11H/b6-4+.
What are the key properties of 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde?
3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde has a molecular weight of 295.29 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(6,7-difluoroquinolin-2-yl)ethenyl]benzaldehyde is sourced from PubChem (CID 19918772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).