About 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one
5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 19918951) has the molecular formula C13H13ClO3
and a molecular weight of 252.70 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one |
| PubChem CID | 19918951 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | CC1=C(c2ccccc2Cl)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C13H13ClO3/c1-8-11(9-6-4-5-7-10(9)14)12(15)17-13(2,3)16-8/h4-7H,1-3H3 |
| InChIKey | AORGZVXKXAOUIG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one?
The IUPAC name of 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one (CID 19918951) is 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one?
The canonical SMILES for 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one is CC1=C(c2ccccc2Cl)C(=O)OC(C)(C)O1.
What is the InChIKey of 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one?
The InChIKey is AORGZVXKXAOUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO3/c1-8-11(9-6-4-5-7-10(9)14)12(15)17-13(2,3)16-8/h4-7H,1-3H3.
What are the key properties of 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one?
5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one has a molecular weight of 252.70 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)-2,2,6-trimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 19918951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).