C24H27F3N4O4 — CID 19919867
methyl 4-[[2-butyl-5-[(Z)-[2,5-dioxo-1-(4,4,4-trifluorobutyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate (PubChem CID 19919867) has the molecular formula C24H27F3N4O4 and a molecular weight of 492.50 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(Z)-[2,5-dioxo-1-(4,4,4-trifluorobutyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-butyl-5-[(Z)-[2,5-dioxo-1-(4,4,4-trifluorobutyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19919867 |
| Molecular Formula | C24H27F3N4O4 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(Z)-[2,5-dioxo-1-(4,4,4-trifluorobutyl)imidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(/C=C2\NC(=O)N(CCCC(F)(F)F)C2=O)n1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C24H27F3N4O4/c1-3-4-6-20-28-14-18(31(20)15-16-7-9-17(10-8-16)22(33)35-2)13-19-21(32)30(23(34)29-19)12-5-11-24(25,26)27/h7-10,13-14H,3-6,11-12,15H2,1-2H3,(H,29,34)/b19-13- |
| InChIKey | YUKFFBIQDSIVRI-UYRXBGFRSA-N |
| XLogP | 4.30 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|