C15H16N2O5 — CID 19919893
(E)-but-2-enedioic acid;spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene] (PubChem CID 19919893) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene].
| Compound Name | (E)-but-2-enedioic acid;spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene] |
|---|---|
| PubChem CID | 19919893 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (E)-but-2-enedioic acid;spiro[1,4-dihydroimidazole-5,3'-2,4-dihydrochromene] |
| SMILES | C1=NCC2(COc3ccccc3C2)N1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H12N2O.C4H4O4/c1-2-4-10-9(3-1)5-11(7-14-10)6-12-8-13-11;5-3(6)1-2-4(7)8/h1-4,8H,5-7H2,(H,12,13);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RLOQVGZAMNDEJF-WLHGVMLRSA-N |
| XLogP | 0.70 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|