About 2,5-diaminobenzene-1,3-diol;dihydrochloride
2,5-diaminobenzene-1,3-diol;dihydrochloride (PubChem CID 19920045) has the molecular formula C6H10Cl2N2O2
and a molecular weight of 213.06 g/mol. Its IUPAC name is 2,5-diaminobenzene-1,3-diol;dihydrochloride.
Molecular Properties
| Compound Name | 2,5-diaminobenzene-1,3-diol;dihydrochloride |
| PubChem CID | 19920045 |
| Molecular Formula | C6H10Cl2N2O2 |
| Molecular Weight | 213.06 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 2,5-diaminobenzene-1,3-diol;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(O)c(N)c(O)c1 |
| InChI | InChI=1S/C6H8N2O2.2ClH/c7-3-1-4(9)6(8)5(10)2-3;;/h1-2,9-10H,7-8H2;2*1H |
| InChIKey | AXMVNCSMMPTLOJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.06 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diaminobenzene-1,3-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diaminobenzene-1,3-diol;dihydrochloride?
The IUPAC name of 2,5-diaminobenzene-1,3-diol;dihydrochloride (CID 19920045) is 2,5-diaminobenzene-1,3-diol;dihydrochloride.
What is the SMILES notation for 2,5-diaminobenzene-1,3-diol;dihydrochloride?
The canonical SMILES for 2,5-diaminobenzene-1,3-diol;dihydrochloride is Cl.Cl.Nc1cc(O)c(N)c(O)c1.
What is the InChIKey of 2,5-diaminobenzene-1,3-diol;dihydrochloride?
The InChIKey is AXMVNCSMMPTLOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.2ClH/c7-3-1-4(9)6(8)5(10)2-3;;/h1-2,9-10H,7-8H2;2*1H.
What are the key properties of 2,5-diaminobenzene-1,3-diol;dihydrochloride?
2,5-diaminobenzene-1,3-diol;dihydrochloride has a molecular weight of 213.06 g/mol, XLogP of 1.11, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diaminobenzene-1,3-diol;dihydrochloride is sourced from PubChem (CID 19920045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).