1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid

C11H20O4 — CID 19920100

IUPAC1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid
SMILESCOC(CCC1(C(=O)O)CCCC1)OC
InChIInChI=1S/C11H20O4/c1-14-9(15-2)5-8-11(10(12)13)6-3-4-7-11/h9H,3-8H2,1-2H3,(H,12,13)
InChIKeyCKPKNVFGWZCDRK-UHFFFAOYSA-N
MW216.28 g/mol
LogP2.03
Rot. Bonds6

About 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid

1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid (PubChem CID 19920100) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid
PubChem CID19920100
Molecular FormulaC11H20O4
Molecular Weight216.28 g/mol
Exact Mass216.14
IUPAC Name1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid
SMILESCOC(CCC1(C(=O)O)CCCC1)OC
InChIInChI=1S/C11H20O4/c1-14-9(15-2)5-8-11(10(12)13)6-3-4-7-11/h9H,3-8H2,1-2H3,(H,12,13)
InChIKeyCKPKNVFGWZCDRK-UHFFFAOYSA-N
XLogP2.03
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid?
The IUPAC name of 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid (CID 19920100) is 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid is COC(CCC1(C(=O)O)CCCC1)OC.
What is the InChIKey of 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid?
The InChIKey is CKPKNVFGWZCDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-14-9(15-2)5-8-11(10(12)13)6-3-4-7-11/h9H,3-8H2,1-2H3,(H,12,13).
What are the key properties of 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid?
1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid has a molecular weight of 216.28 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethoxypropyl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 19920100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).