About 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide
2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide (PubChem CID 19920468) has the molecular formula C12H15BrN2O2S
and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide |
| PubChem CID | 19920468 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide |
| SMILES | CN1C2=C(CC(=O)C=C2)SC1CCNC(=O)CBr |
| InChI | InChI=1S/C12H15BrN2O2S/c1-15-9-3-2-8(16)6-10(9)18-12(15)4-5-14-11(17)7-13/h2-3,12H,4-7H2,1H3,(H,14,17) |
| InChIKey | VIRGWBWGRRCNAY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide?
The IUPAC name of 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide (CID 19920468) is 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide.
What is the SMILES notation for 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide?
The canonical SMILES for 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide is CN1C2=C(CC(=O)C=C2)SC1CCNC(=O)CBr.
What is the InChIKey of 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide?
The InChIKey is VIRGWBWGRRCNAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2O2S/c1-15-9-3-2-8(16)6-10(9)18-12(15)4-5-14-11(17)7-13/h2-3,12H,4-7H2,1H3,(H,14,17).
What are the key properties of 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide?
2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide has a molecular weight of 331.24 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[2-(3-methyl-6-oxo-2,7-dihydro-1,3-benzothiazol-2-yl)ethyl]acetamide is sourced from PubChem (CID 19920468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).