C30H39NO8 — CID 19921609
N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]butanamide (PubChem CID 19921609) has the molecular formula C30H39NO8 and a molecular weight of 541.64 g/mol. Its IUPAC name is N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]butanamide.
| Compound Name | N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]butanamide |
|---|---|
| PubChem CID | 19921609 |
| Molecular Formula | C30H39NO8 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | N-hydroxy-N-[3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]prop-1-ynyl]butanamide |
| SMILES | CCCOc1c(CC#CN(O)C(=O)CCC)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc1OC |
| InChI | InChI=1S/C30H39NO8/c1-7-10-28(32)31(33)14-9-11-20-16-21(17-25(34-3)29(20)38-15-8-2)23-12-13-24(39-23)22-18-26(35-4)30(37-6)27(19-22)36-5/h16-19,23-24,33H,7-8,10-13,15H2,1-6H3 |
| InChIKey | UVRKYXMHLVIUDQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|