About 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole
5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole (PubChem CID 19921852) has the molecular formula C7H5F2NO
and a molecular weight of 157.12 g/mol. Its IUPAC name is 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole |
| PubChem CID | 19921852 |
| Molecular Formula | C7H5F2NO |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole |
| SMILES | CC#Cc1cc(C(F)F)on1 |
| InChI | InChI=1S/C7H5F2NO/c1-2-3-5-4-6(7(8)9)11-10-5/h4,7H,1H3 |
| InChIKey | UXMJBEJIKDYJGI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole?
The IUPAC name of 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole (CID 19921852) is 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole.
What is the SMILES notation for 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole?
The canonical SMILES for 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole is CC#Cc1cc(C(F)F)on1.
What is the InChIKey of 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole?
The InChIKey is UXMJBEJIKDYJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2NO/c1-2-3-5-4-6(7(8)9)11-10-5/h4,7H,1H3.
What are the key properties of 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole?
5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole has a molecular weight of 157.12 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-3-prop-1-ynyl-1,2-oxazole is sourced from PubChem (CID 19921852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).